CAS 7324-05-2
:L-Alaninamide
Description:
L-Alaninamide, with the CAS number 7324-05-2, is an organic compound that serves as an amide derivative of the amino acid L-alanine. It is characterized by the presence of an amine group (-NH2) and a carboxyl group (-COOH), which are typical features of amino acids. This compound is typically a white crystalline solid and is soluble in water, reflecting its polar nature due to the functional groups present. L-Alaninamide is often utilized in biochemical research and may play a role in various metabolic processes. Its structure allows it to participate in peptide synthesis and other reactions involving amino acids. Additionally, it may exhibit biological activity, making it of interest in pharmacological studies. As with many amides, it is expected to have relatively low volatility and stability under standard conditions, although specific reactivity can depend on the surrounding environment and conditions. Overall, L-Alaninamide is a significant compound in both organic chemistry and biochemistry, contributing to the understanding of amino acid derivatives and their applications.
Formula:C3H8N2O
InChI:InChI=1/C3H8N2O/c1-2(4)3(5)6/h2H,4H2,1H3,(H2,5,6)/t2-/m0/s1
InChI key:InChIKey=HQMLIDZJXVVKCW-REOHCLBHSA-N
SMILES:[C@@H](C(N)=O)(C)N
Synonyms:- (2S)-2-Aminopropanamide
- (2S)-2-Aminopropionamide
- (S)-(+)-2-Aminopropanamide
- (S)-2-Amino-propionamide
- <span class="text-smallcaps">L</span>-Alaninamide
- <span class="text-smallcaps">L</span>-Alanine amide
- Alaninamide, <span class="text-smallcaps">L</span>-
- Alanine amide
- H-Ala-NH<sub>2</sub>
- N-Acetyl-L-Alanine Amide
- Propanamide, 2-amino-, (2S)-
- Propanamide, 2-amino-, (S)-
- S-Alaninamide
- [(S)-1-(Aminocarbonyl)ethyl]amine
- L-Alaninamide
- Alaninamide, L-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
L-Alaninamide
CAS:L-Alaninamide is a protonated amino acid that reacts with the bacterial cell membrane and causes it to rupture. L-Alaninamide is synthesized by hydrolysis of the ester bond between butyric acid and serine protease in the presence of immobilized d-alanine. The reaction is carried out at a pH of 5.5, and the release of pressor is observed. This reaction takes place in an aqueous solution containing fatty acids as solvents. The type strain of this amino acid is E. coli.
Formula:C3H8N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:88.11 g/molRef: 3D-FA63428
Discontinued product




