CAS 7324-17-6

S-(methylcarbamoyl)-L-cysteine

Description:

S-(Methylcarbamoyl)-L-cysteine, with the CAS number 7324-17-6, is an amino acid derivative that features a cysteine backbone modified by a methylcarbamoyl group. This compound is characterized by the presence of a thiol (-SH) group, which is typical of cysteine, allowing it to participate in redox reactions and form disulfide bonds. The methylcarbamoyl group introduces a carbamoyl functional group, which can influence the compound's solubility and reactivity. S-(Methylcarbamoyl)-L-cysteine is often studied for its potential biological activities, including its role in cellular processes and as a precursor in the synthesis of various biomolecules. Its structure allows for interactions with other biomolecules, making it relevant in biochemical research. Additionally, the compound may exhibit properties such as antioxidant activity due to the presence of the thiol group, which can scavenge free radicals. Overall, S-(methylcarbamoyl)-L-cysteine is of interest in both pharmaceutical and biochemical contexts due to its unique structural features and potential applications.

Formula: C₅H₁₀N₂O₃S

InChI: InChI=1/C5H10N2O3S/c1-7-5(10)11-2-3(6)4(8)9/h3H,2,6H2,1H3,(H,7,10)(H,8,9)/t3-/m0/s1

SMILES: CN=C(O)SC[C@@H](C(=O)O)N

S-(N-Methylcarbamoyl)-L-cysteine

Controlled Product

CAS: 7324-17-6

Formula: C₅H₁₀N₂O₃S

Color and Shape: Neat

Molecular weight: 178.209

Ref: TR-M294490