CAS 7324-41-6
:(8E,11E,14E)-icosa-8,11,14-trienoic acid
Description:
(8E,11E,14E)-icosa-8,11,14-trienoic acid, also known as icosatrienoic acid, is a polyunsaturated fatty acid characterized by its long carbon chain consisting of 20 carbon atoms and three double bonds located at the 8th, 11th, and 14th positions, all in the trans configuration. This structure contributes to its unique physical and chemical properties, including a relatively low melting point compared to saturated fatty acids, which allows it to remain liquid at room temperature. It is typically found in certain plant oils and is of interest in nutritional and biochemical research due to its potential health benefits, including anti-inflammatory properties. The presence of multiple double bonds makes it susceptible to oxidation, which can affect its stability and shelf life. Additionally, its role in cellular membranes and metabolic processes highlights its importance in biochemistry and nutrition. As a fatty acid, it can be involved in various biochemical pathways, including those related to energy metabolism and signaling.
Formula:C20H34O2
InChI:InChI=1/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,12-13H,2-5,8,11,14-19H2,1H3,(H,21,22)/b7-6+,10-9+,13-12+
Synonyms:- 8,11,14-eicosatrienoic acid, (8E,11E,14E)-
- Eicosa-8,11,14-Trienoic Acid
- (8E,11E,14E)-Icosa-8,11,14-trienoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(8E,11E,14E)-Icosa-8,11,14-trienoic acid
CAS:(8E,11E,14E)-Icosa-8,11,14-trienoic acid is a potent inhibitor of the protein interactions that are necessary for the assembly and function of ion channels. It also inhibits the activation of receptors by ligands and can be used to study receptor-ligand binding. (8E,11E,14E)-Icosa-8,11,14-trienoic acid is a chiral molecule with an enantiomeric purity greater than 98%. This product has been shown to inhibit voltage-gated potassium channels in both rat and human cells.Formula:C20H34O2Purity:Min. 95%Molecular weight:306.5 g/mol
