CAS 7324-84-7

2-cyano-3-(4-methoxyphenyl)prop-2-enamide

Description:

2-Cyano-3-(4-methoxyphenyl)prop-2-enamide, with the CAS number 7324-84-7, is an organic compound characterized by its functional groups and structural features. It contains a cyano group (-CN), an amide group (-C(=O)NH2), and a prop-2-enamide backbone, which contributes to its reactivity and potential applications in organic synthesis. The presence of the 4-methoxyphenyl substituent enhances its aromatic character and may influence its solubility and interaction with biological systems. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the presence of the cyano and amide groups. Its chemical properties, such as reactivity and stability, can be influenced by the electronic effects of the methoxy group, which can act as an electron-donating substituent. Overall, 2-cyano-3-(4-methoxyphenyl)prop-2-enamide is of interest in various fields, including medicinal chemistry and materials science, due to its unique structural attributes and potential biological activities.

Formula: C₁₁H₁₀N₂O₂

InChI: InChI=1/C11H10N2O2/c1-15-10-4-2-8(3-5-10)6-9(7-12)11(13)14/h2-6H,1H3,(H2,13,14)

SMILES: COc1ccc(cc1)C=C(C#N)C(=N)O