CymitQuimica logo

CAS 73241-57-3

:

4-Benzoylphenyl methyl sulfoxide

Description:
4-Benzoylphenyl methyl sulfoxide, identified by its CAS number 73241-57-3, is an organic compound characterized by the presence of a sulfoxide functional group attached to a benzoylphenyl moiety. This compound typically exhibits a white to off-white crystalline appearance. The sulfoxide group contributes to its polar nature, enhancing its solubility in polar solvents while maintaining some solubility in non-polar solvents due to the aromatic rings. It is known for its potential applications in organic synthesis and as a reagent in various chemical reactions, particularly in the field of medicinal chemistry. The presence of the benzoyl group may impart specific reactivity patterns, making it useful in the synthesis of other complex molecules. Additionally, the compound may exhibit interesting biological activities, although specific studies would be required to elucidate its pharmacological properties. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H12O2S
InChI:InChI=1/C14H12O2S/c1-17(16)13-9-7-12(8-10-13)14(15)11-5-3-2-4-6-11/h2-10H,1H3
SMILES:CS(=O)c1ccc(cc1)C(=O)c1ccccc1
Synonyms:
  • [4-(Methylsulfinyl)phenyl]phenylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.