CAS 73242-06-5

2-Furanyl[4-(methylthio)phenyl]methanone

Description:

2-Furanyl[4-(methylthio)phenyl]methanone, with the CAS number 73242-06-5, is an organic compound characterized by its unique structure that includes a furan ring and a phenyl group substituted with a methylthio group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The furan moiety contributes to its aromatic character, while the methylthio group can influence its electronic properties and reactivity. In terms of solubility, compounds of this nature are often soluble in organic solvents but may have limited solubility in water due to their hydrophobic characteristics. The compound may also exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its synthesis and applications can vary, often involving reactions typical of carbonyl compounds and heterocycles. As with any chemical substance, safety precautions should be taken when handling it, and its properties should be thoroughly evaluated in the context of its intended use.

Formula: C₁₂H₁₀O₂S

InChI: InChI=1S/C12H10O2S/c1-15-10-6-4-9(5-7-10)12(13)11-3-2-8-14-11/h2-8H,1H3

InChI key: InChIKey=UDZNAQBLAHNASU-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(SC)C=C1)C2=CC=CO2

Synonyms:

• 2-Furanyl[4-(methylthio)phenyl]methanone
• 2-[4-(Methylsulfanyl)benzoyl]furan
• Methanone, 2-furanyl[4-(methylthio)phenyl]-