CAS 73242-10-1

(3,4-Dichlorophenyl)[4-(methylthio)phenyl]methanone

Description:

(3,4-Dichlorophenyl)[4-(methylthio)phenyl]methanone, with the CAS number 73242-10-1, is an organic compound characterized by its complex structure, which includes a dichlorophenyl group and a methylthio-substituted phenyl group attached to a carbonyl moiety. This compound typically exhibits properties associated with aromatic ketones, such as moderate to high stability under standard conditions and potential reactivity due to the presence of electrophilic sites. The dichlorophenyl group contributes to its lipophilicity and may influence its biological activity, while the methylthio group can enhance its solubility in organic solvents. The compound may also display interesting photophysical properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. Its synthesis and handling require standard laboratory safety protocols due to the presence of chlorine substituents, which can pose environmental and health risks. Overall, (3,4-Dichlorophenyl)[4-(methylthio)phenyl]methanone is a notable compound in organic chemistry with potential applications in diverse fields.

Formula: C₁₄H₁₀Cl₂OS

InChI: InChI=1S/C14H10Cl2OS/c1-18-11-5-2-9(3-6-11)14(17)10-4-7-12(15)13(16)8-10/h2-8H,1H3

InChI key: InChIKey=WFXFOBIBDCWEHF-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=C(Cl)C=C1)C2=CC=C(SC)C=C2

Synonyms:

• (3,4-Dichlorophenyl)-(4-methylsulfanylphenyl)methanone
• (3,4-Dichlorophenyl)[4-(methylthio)phenyl]methanone
• 3,4-Dichloro-4′-(methylthio)benzophenone
• Methanone, (3,4-dichlorophenyl)[4-(methylthio)phenyl]-
• (3,4-Dichlorophenyl)[4-(methylsulfanyl)phenyl]methanone