CAS 73242-19-0

2,2-dimethyl-1-[4-(methylsulfanyl)phenyl]propan-1-one

Description:

2,2-Dimethyl-1-[4-(methylsulfanyl)phenyl]propan-1-one, with CAS number 73242-19-0, is an organic compound that belongs to the class of ketones. It features a propanone backbone with two methyl groups and a phenyl ring substituted with a methylthio group. This compound is typically characterized by its relatively low volatility and moderate solubility in organic solvents, making it useful in various chemical applications. Its structure suggests it may exhibit interesting reactivity due to the presence of the ketone functional group, which can participate in nucleophilic addition reactions. Additionally, the methylthio group can influence the compound's electronic properties and reactivity, potentially enhancing its role in organic synthesis or as an intermediate in the production of other chemicals. Safety data indicates that, like many organic solvents and ketones, it should be handled with care, as it may pose health risks upon exposure. Overall, 2,2-dimethyl-1-[4-(methylsulfanyl)phenyl]propan-1-one is a compound of interest in both industrial and research settings.

Formula: C₁₂H₁₆OS

InChI: InChI=1/C12H16OS/c1-12(2,3)11(13)9-5-7-10(14-4)8-6-9/h5-8H,1-4H3

SMILES: CC(C)(C)C(=O)c1ccc(cc1)SC