CAS 73244-53-8

1-[3-(2-Methoxyethoxy)phenyl]ethanone

Description:

1-[3-(2-Methoxyethoxy)phenyl]ethanone, with the CAS number 73244-53-8, is an organic compound characterized by its ketone functional group and an aromatic ring. This compound features a phenyl group substituted with a 2-methoxyethoxy group, which contributes to its solubility and reactivity. The presence of the ethanone moiety indicates that it has a carbonyl group (C=O) adjacent to an ethyl group, which can influence its chemical behavior, particularly in reactions such as nucleophilic addition. The methoxyethoxy substituent enhances the compound's polarity and may affect its interaction with biological systems, making it of interest in medicinal chemistry and materials science. Additionally, the compound's structure suggests potential applications in organic synthesis and as an intermediate in the production of more complex molecules. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Overall, this compound exemplifies the diverse chemistry associated with substituted aromatic ketones.

Formula: C₁₁H₁₄O₃

InChI: InChI=1S/C11H14O3/c1-9(12)10-4-3-5-11(8-10)14-7-6-13-2/h3-5,8H,6-7H2,1-2H3

InChI key: InChIKey=QAYJVTPOOARQLD-UHFFFAOYSA-N

SMILES: O(CCOC)C1=CC(C(C)=O)=CC=C1

Synonyms:

• Ethanone, 1-[3-(2-methoxyethoxy)phenyl]-
• 1-[3-(2-Methoxyethoxy)phenyl]ethan-1-one
• 1-[3-(2-Methoxyethoxy)phenyl]ethanone