CymitQuimica logo

CAS 73249-95-3

:

ethyl 3-methyl-5-oxo-5-phenyl-pentanoate

Description:
Ethyl 3-methyl-5-oxo-5-phenyl-pentanoate, identified by its CAS number 73249-95-3, is an organic compound that belongs to the class of esters. It features a pentanoate backbone, which is characterized by a five-carbon chain with a carbonyl group (ketone) and an ester functional group. The presence of a phenyl group and a methyl group on the carbon chain contributes to its unique chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in flavoring and fragrance applications. Its structure suggests it may participate in various chemical reactions, including esterification and hydrolysis. Additionally, it may exhibit biological activity, which could be of interest in pharmaceutical research. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, ethyl 3-methyl-5-oxo-5-phenyl-pentanoate represents a versatile compound with applications in both industrial and research settings.
Formula:C14H18O3
InChI:InChI=1/C14H18O3/c1-3-17-14(16)10-11(2)9-13(15)12-7-5-4-6-8-12/h4-8,11H,3,9-10H2,1-2H3
SMILES:CCOC(=O)CC(C)CC(=O)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.