CymitQuimica logo

CAS 7325-14-6

:

1,3,5-tricyclohexylbenzene

Description:
1,3,5-Tricyclohexylbenzene is an organic compound characterized by its unique structure, which consists of a benzene ring substituted with three cyclohexyl groups at the 1, 3, and 5 positions. This compound is a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its high viscosity and low volatility, making it useful in various applications, including as a lubricant or in polymer formulations. The presence of multiple cyclohexyl groups contributes to its hydrophobic nature and stability, while also influencing its physical properties, such as melting and boiling points. 1,3,5-Tricyclohexylbenzene is relatively insoluble in water but soluble in organic solvents, which is typical for compounds with large hydrocarbon structures. Additionally, it exhibits good thermal stability, making it suitable for high-temperature applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C24H36
InChI:InChI=1/C24H36/c1-4-10-19(11-5-1)22-16-23(20-12-6-2-7-13-20)18-24(17-22)21-14-8-3-9-15-21/h16-21H,1-15H2
SMILES:C1CCC(CC1)c1cc(cc(c1)C1CCCCC1)C1CCCCC1
Synonyms:
  • Benzene, 1,3,5-Tricyclohexyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.