CAS 73252-09-2

(3aS,4R,5R,7S,7aR)-5-phenylhexahydro-4,7-methano-2-benzofuran-1,3-dione

Description:

The chemical substance with the name "(3aS,4R,5R,7S,7aR)-5-phenylhexahydro-4,7-methano-2-benzofuran-1,3-dione" and CAS number "73252-09-2" is a complex organic compound characterized by its unique bicyclic structure, which includes a benzofuran moiety and a phenyl group. This compound features multiple stereocenters, contributing to its chiral nature, which can influence its biological activity and interactions. The presence of the dione functional groups indicates that it has two carbonyl groups, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The hexahydro framework suggests that the compound is saturated, which may affect its stability and reactivity. Additionally, the phenyl group can enhance the lipophilicity of the molecule, potentially influencing its solubility and permeability in biological systems. Overall, this compound's structural complexity and functional groups suggest potential applications in pharmaceuticals or as a synthetic intermediate in organic chemistry.

Formula: C₁₅H₁₄O₃

InChI: InChI=1/C15H14O3/c16-14-12-9-6-10(8-4-2-1-3-5-8)11(7-9)13(12)15(17)18-14/h1-5,9-13H,6-7H2/t9-,10+,11-,12-,13+/m1/s1

Synonyms:

• (1S,2R,6S,7R,8R)-8-Phenyl-4-oxatricyclo[5.2.1.02,6

(3aS,4R,5R,7S,7aR)-5-Phenylhexahydro-4,7-methano-2-benzofuran-1,3-dione

CAS: 73252-09-2

(3aS,4R,5R,7S,7aR)-5-Phenylhexahydro-4,7-methano-2-benzofuran-1,3-dione

Purity: ≥95%

Molecular weight: 242.27g/mol

Ref: 54-OR307553