CAS 73253-30-2
:5,7-dichloro-1,2,3,4-tetrahydroquinoline hydrochloride
Description:
5,7-Dichloro-1,2,3,4-tetrahydroquinoline hydrochloride is a chemical compound characterized by its bicyclic structure, which includes a quinoline moiety. This substance features two chlorine atoms substituted at the 5 and 7 positions of the quinoline ring, contributing to its unique chemical properties. The tetrahydro form indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring structure that enhances its stability and solubility in various solvents. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of potential therapeutic agents. Its molecular interactions, including hydrogen bonding and hydrophobic effects, can influence its pharmacokinetics and pharmacodynamics. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C9H10Cl3N
InChI:InChI=1/C9H9Cl2N.ClH/c10-6-4-8(11)7-2-1-3-12-9(7)5-6;/h4-5,12H,1-3H2;1H
SMILES:C1Cc2c(cc(cc2NC1)Cl)Cl.Cl
Synonyms:- 5,7-Dichloro-1,2,3,4-tetrahydroquinoline hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
