CAS 73255-40-0
:4-(α-L-Rhamnosyloxy)benzyl isothiocyanate
Description:
4-(α-L-Rhamnosyloxy)benzyl isothiocyanate is a chemical compound characterized by its isothiocyanate functional group, which is known for its potential biological activities, including anticancer and antimicrobial properties. This compound features a benzyl group substituted with an α-L-rhamnosyloxy moiety, which contributes to its solubility and reactivity. The presence of the rhamnose sugar enhances its interaction with biological systems, potentially influencing its pharmacological effects. Isothiocyanates are derived from glucosinolates and are commonly found in cruciferous vegetables, where they are believed to play a role in the plant's defense mechanisms. The compound's structure suggests it may exhibit unique properties related to its ability to modulate various biological pathways. Additionally, its CAS number, 73255-40-0, allows for precise identification in chemical databases and literature. Overall, 4-(α-L-Rhamnosyloxy)benzyl isothiocyanate represents a fascinating area of study within natural product chemistry and its applications in health and disease.
Formula:C14H17NO5S
InChI:InChI=1/C14H17NO5S/c1-8-11(16)12(17)13(18)14(19-8)20-10-4-2-9(3-5-10)6-15-7-21/h2-5,8,11-14,16-18H,6H2,1H3/t8-,11-,12+,13+,14-/m0/s1
InChI key:InChIKey=QAZIHHJTZPNRCM-CNJBRALLSA-N
SMILES:O([C@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O1)C2=CC=C(CN=C=S)C=C2
Synonyms:- 4-(Isothiocyanatomethyl)phenyl 6-deoxy-α-<span class="text-smallcaps">L</span>-mannopyranoside
- 4-(α-<span class="text-smallcaps">L</span>-Rhamnosyloxy)benzyl isothiocyanate
- Moringin
- alpha-L-Mannopyranoside, 4-(isothiocyanatomethyl)phenyl 6-deoxy-
- α-<span class="text-smallcaps">L</span>-Mannopyranoside, 4-(isothiocyanatomethyl)phenyl 6-deoxy-
- 4-(Isothiocyanatomethyl)phenyl 6-deoxy-α-L-mannopyranoside
- α-L-Mannopyranoside, 4-(isothiocyanatomethyl)phenyl 6-deoxy-
- 4-(α-L-Rhamnosyloxy)benzyl isothiocyanate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
α-L-Mannopyranoside, 4-(isothiocyanatomethyl)phenyl 6-deoxy-
CAS:Formula:C14H17NO5SPurity:95%Color and Shape:SolidMolecular weight:311.3535Ref: IN-DA01QCK1
1mg217.00€10mg286.00€20mg608.00€50mgTo inquire100mgTo inquire200mgTo inquire500mgTo inquireMoringin
CAS:Formula:C14H17NO5SPurity:≥ 98.0%Color and Shape:White to light-yellow powderMolecular weight:311.35Moringin
CAS:Moringin, from Moringa oleifera seeds, is an isothiocyanate with anti-inflammatory and antioxidant traits.Formula:C14H17NO5SPurity:99.88%Color and Shape:SolidMolecular weight:311.35Moringin
CAS:Moringin is a bioactive compound, which is derived from the seeds of the Moringa oleifera tree, a plant native to parts of Africa and Asia. Moringin acts primarily through its isothiocyanate group, which enables it to interact with various molecular targets within cells. This interaction can modulate signaling pathways that are integral to inflammatory and oxidative stress responses.Formula:C14H17NO5SPurity:Min. 95%Color and Shape:PowderMolecular weight:311.36 g/mol





