CymitQuimica logo

CAS 73257-80-4

:

N-[1-(morpholin-4-yl)-3-phenylbutan-2-yl]decanamide hydrochloride (1:1)

Description:
N-[1-(morpholin-4-yl)-3-phenylbutan-2-yl]decanamide hydrochloride is a synthetic compound characterized by its complex structure, which includes a decanamide backbone and a morpholine ring. This substance typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential bioactivity due to its amine and aromatic components. The presence of the morpholine moiety suggests possible interactions with biological systems, making it of interest in medicinal chemistry. The hydrochloride salt form enhances its stability and solubility in aqueous environments, which is advantageous for pharmaceutical applications. As a compound with a specific stereochemistry, it may exhibit unique pharmacological properties, including potential effects on neurotransmitter systems or other biological pathways. Safety and handling precautions are essential, as with any chemical substance, particularly in laboratory or industrial settings. Overall, this compound represents a class of molecules that may have therapeutic potential, warranting further investigation into its biological activity and applications.
Formula:C24H41ClN2O2
InChI:InChI=1/C24H40N2O2.ClH/c1-3-4-5-6-7-8-12-15-24(27)25-23(20-26-16-18-28-19-17-26)21(2)22-13-10-9-11-14-22;/h9-11,13-14,21,23H,3-8,12,15-20H2,1-2H3,(H,25,27);1H
SMILES:CCCCCCCCCC(=NC(CN1CCOCC1)C(C)c1ccccc1)O.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • PDMP (hydrochloride)

    CAS:
    <p>PDMP, a glucosylceramide synthase inhibitor with 4 stereoisomers, acts at 0.8μM; D-threo enantiomer also blocks lactosylceramide synthesis.</p>
    Formula:C23H39ClN2O3
    Color and Shape:Solid
    Molecular weight:427.03