CAS 73259-81-1
:N(alpha)-boc-L-2,3-diaminopropionic acid
Description:
N(alpha)-Boc-L-2,3-diaminopropionic acid is a protected form of the amino acid 2,3-diaminopropionic acid, which is notable for its role in peptide synthesis and as a building block in the development of various pharmaceuticals. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amino functionality, enhancing the stability and solubility of the compound during chemical reactions. This substance typically appears as a white to off-white crystalline solid and is soluble in polar organic solvents. Its molecular structure features two amine groups, which can participate in various chemical reactions, making it versatile in synthetic chemistry. The compound is often used in the synthesis of peptides and other complex molecules due to its ability to facilitate the formation of peptide bonds. Additionally, it may exhibit biological activity, although specific biological properties would depend on the context of its use. Proper handling and storage conditions are essential to maintain its integrity and reactivity in laboratory settings.
Formula:C8H16N2O4
InChI:InChI=1/C8H16N2O4/c1-8(2,3)14-7(13)10-5(4-9)6(11)12/h5H,4,9H2,1-3H3,(H,10,13)(H,11,12)/t5-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](CN)C(=O)O)O
Synonyms:- Boc-Dap-OH
- Boc-Dpr-OH, N-Boc-L-2,3-diaminopropanoic acid
- Na-Boc-L-2,3-diaminopropionic acid
- N-t-BOC--amino-L-alanine
- Boc-Dap
- 3-amino-N-(tert-butoxycarbonyl)-L-alanine
- N-alpha-L-(Butoxycarbonyl)-2,3-diaminopropionic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(S)-3-Amino-2-(tert-butoxycarbonylamino)propionic Acid
CAS:Formula:C8H16N2O4Purity:>95.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:204.23Boc-Dap-OH
CAS:Bachem ID: 4015642.
Formula:C8H16N2O4Purity:> 99%Color and Shape:Light Yellow PowderMolecular weight:204.23N-α-L-(Butoxycarbonyl)-2,3-diaminopropionic acid
CAS:Formula:C8H16N2O4Purity:97%Color and Shape:SolidMolecular weight:204.22363-Amino-N-(tert-butoxycarbonyl)-L-alanine
CAS:3-Amino-N-(tert-butoxycarbonyl)-L-alanineFormula:C8H16N2O4Purity:96%Color and Shape: white to off-white solidMolecular weight:204.22g/molBoc-L-2,3-Diaminopropionic acid
CAS:Formula:C8H16N2O4Purity:95%Color and Shape:SolidMolecular weight:204.226N-alpha-Boc-L-2,3-diaminopropionic acid
CAS:N-alpha-Boc-L-2,3-diaminopropionic acid is a synthetic amino acid that has been shown to have anticancer properties. The amino acid contains a functional group with two carboxylates and a disulfide bond. It has also been shown to inhibit the nuclear factor kappa B ligand (NFκB) and hepg2 cells, leading to cell death. This agent is a glycopeptide conjugate that inhibits the growth of mammalian cells by preventing protein synthesis. N-alpha-Boc-L-2,3-diaminopropionic acid has been shown to be cytotoxic in vitro against human leukemia HL60 cells.Formula:C8H16N2O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:204.22 g/molN(α)-Boc-L-2,3-diaminopropionic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Formula:C8H16N2O4Purity:97%Color and Shape:Powder, WhiteMolecular weight:204.23







