CAS 73259-83-3
:Octahydro-2H-quinolizine-3-carbonitrile
Description:
Octahydro-2H-quinolizine-3-carbonitrile is a bicyclic organic compound characterized by its unique structure, which includes a quinolizine core and a cyano group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to biologically active compounds. The presence of the cyano group contributes to its reactivity, allowing for various chemical transformations. Octahydro-2H-quinolizine-3-carbonitrile is generally soluble in organic solvents, and its stability can vary based on environmental conditions such as temperature and pH. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance. Overall, this compound represents an interesting area of study in organic synthesis and drug development, with ongoing research into its properties and applications.
Formula:C10H16N2
InChI:InChI=1S/C10H16N2/c11-7-9-4-5-10-3-1-2-6-12(10)8-9/h9-10H,1-6,8H2
InChI key:InChIKey=BQSDHIMENRTWTN-UHFFFAOYSA-N
SMILES:C(#N)C1CN2C(CC1)CCCC2
Synonyms:- 1-Azabicyclo[4.4.0]decane-3-carbonitrile
- 2H-Quinolizine-3-carbonitrile, octahydro-
- 2,3,4,6,7,8,9,9a-Octahydro-1H-quinolizine-3-carbonitrile
- Octahydro-2H-quinolizine-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.