CAS 7326-74-1

3-[(Ethylamino)sulfonyl]benzoic acid

Description:

3-[(Ethylamino)sulfonyl]benzoic acid, with the CAS number 7326-74-1, is an organic compound characterized by its sulfonamide functional group attached to a benzoic acid structure. This compound features an ethylamino group, which contributes to its basicity and potential for forming hydrogen bonds. The sulfonyl group enhances its solubility in polar solvents, making it useful in various chemical applications. The presence of the carboxylic acid group provides acidic properties, allowing it to participate in acid-base reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, which could lead to therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the surrounding pH and the presence of other functional groups in a reaction environment. Overall, 3-[(Ethylamino)sulfonyl]benzoic acid is a versatile compound with significant implications in both synthetic chemistry and medicinal chemistry.

Formula: C₉H₁₁NO₄S

InChI: InChI=1S/C9H11NO4S/c1-2-10-15(13,14)8-5-3-4-7(6-8)9(11)12/h3-6,10H,2H2,1H3,(H,11,12)

InChI key: InChIKey=GLQZYZFUALLUSS-UHFFFAOYSA-N

SMILES: S(NCC)(=O)(=O)C1=CC(C(O)=O)=CC=C1

Synonyms:

• Benzoic acid, 3-[(ethylamino)sulfonyl]-
• 3-Ethylsulfamoyl-benzoic acid
• 3-(Ethylsulfamoyl)benzoic acid
• NSC 85502
• 3-[(Ethylamino)sulfonyl]benzoic acid
• benzoic acid, 3-[(ethylamino)sulfonyl]-
• Benzoic acid, m-(ethylsulfamoyl)-

3-(Ethylaminosulfonyl)benzoic acid

CAS: 7326-74-1

Formula: C₉H₁₁NO₄S

Molecular weight: 229.2529

Ref: IN-DA0061SR