CAS 7326-76-3

3-[[(1-Methylpropyl)amino]sulfonyl]benzoic acid

Description:

3-[[(1-Methylpropyl)amino]sulfonyl]benzoic acid, with the CAS number 7326-76-3, is an organic compound characterized by its sulfonamide functional group and a carboxylic acid moiety. This compound features a benzoic acid core substituted with a sulfonamide group, which is linked to a branched alkyl amine, specifically 1-methylpropyl. The presence of the sulfonyl group contributes to its potential as a polar molecule, influencing its solubility in various solvents. The carboxylic acid group imparts acidic properties, allowing it to participate in acid-base reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its structural features suggest potential interactions with biological macromolecules, which could be explored for therapeutic applications. Overall, 3-[[(1-Methylpropyl)amino]sulfonyl]benzoic acid is a compound of interest due to its unique functional groups and potential utility in medicinal chemistry.

Formula: C₁₁H₁₅NO₄S

InChI: InChI=1S/C11H15NO4S/c1-3-8(2)12-17(15,16)10-6-4-5-9(7-10)11(13)14/h4-8,12H,3H2,1-2H3,(H,13,14)

InChI key: InChIKey=MQMUKJSWCWYSGL-UHFFFAOYSA-N

SMILES: S(NC(CC)C)(=O)(=O)C1=CC(C(O)=O)=CC=C1

Synonyms:

• 3-[(Butan-2-yl)sulfamoyl]benzoic acid
• 3-[(Sec-Butylamino)Sulfonyl]Benzoic Acid
• 3-[[(1-Methylpropyl)amino]sulfonyl]benzoic acid
• Benzoic acid, 3-[[(1-methylpropyl)amino]sulfonyl]-
• Benzoic acid, m-(sec-butylsulfamoyl)-

3-[(Butan-2-yl)sulfamoyl]benzoic acid

CAS: 7326-76-3

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO₄S

Purity: Min. 95%

Molecular weight: 257.31 g/mol

Ref: 3D-HAA32676