CAS 73262-04-1

2-amino-6-bromo-3-formylchromone

Description:

2-Amino-6-bromo-3-formylchromone is a chemical compound belonging to the chromone family, characterized by its chromone backbone with specific functional groups. This compound features an amino group (-NH2) and a formyl group (-CHO) at the 3 and 6 positions, respectively, along with a bromine atom at the 6 position, which contributes to its reactivity and potential biological activity. The presence of the formyl group suggests that it can participate in various chemical reactions, such as condensation and nucleophilic addition. The bromine substituent can enhance the compound's lipophilicity and may influence its interaction with biological targets. 2-Amino-6-bromo-3-formylchromone may exhibit fluorescence properties, making it useful in analytical applications. Additionally, compounds of this type have been studied for their potential pharmacological activities, including antimicrobial and anticancer properties. As with many organic compounds, its solubility, stability, and reactivity can be influenced by the surrounding environment, including pH and solvent polarity.

Formula: C₁₀H₆BrNO₃

InChI: InChI=1/C10H6BrNO3/c11-5-1-2-8-6(3-5)9(14)7(4-13)10(12)15-8/h1-4H,12H2

SMILES: c1cc2c(cc1Br)c(=O)c(C=O)c(N)o2

Synonyms:

• 2-amino-6-bromo-4-oxo-4H-chromene-3-carbaldehyde

2-Amino-6-bromo-3-formylchromone

CAS: 73262-04-1

Formula: C₁₀H₆BrNO₃

Molecular weight: 268.0635

Ref: IN-DA00FBAM

2-Amino-6-bromo-3-formylchromone

CAS: 73262-04-1

2-Amino-6-bromo-3-formylchromone

Purity: ≥95%

Molecular weight: 268.06g/mol

Ref: 54-OR322331

2-Amino-6-bromo-3-formylchromone

CAS: 73262-04-1

2-Amino-6-bromo-3-formylchromone is a chemical compound with the molecular formula CHNO. It has a vibrational frequency of 1426.81 cm−1 and a potential energy of −29.35 kcal/mol. The molecule can be classified as an aromatic compound, due to the presence of one or more benzene rings in its structure, and is colored red or orange in solution. 2-Amino-6-bromo-3-formylchromone can be used to produce other compounds that have different spectral properties than it does, such as 2-(2-(2-(2-(2-(2-(benzoyloxy)ethoxy)ethoxy)ethoxy)ethoxy)ethoxy)-4'-nitroacetophenone.

Formula: C₁₀H₆BrNO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 268.06 g/mol

Ref: 3D-FA55280