CAS 73264-12-7
:N-(3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-6-yl)-2-iodoacetamide
Description:
N-(3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-6-yl)-2-iodoacetamide is a complex organic compound characterized by its unique structural features, including a spirocyclic framework that incorporates both benzofuran and xanthen moieties. This compound contains hydroxyl groups, which contribute to its potential solubility in polar solvents and may influence its reactivity and biological activity. The presence of the iodoacetamide functional group suggests that it may participate in nucleophilic substitution reactions, making it a candidate for various chemical transformations. Additionally, the compound's structure may confer specific optical properties, potentially making it useful in applications such as fluorescence or as a dye. Its molecular weight, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, this compound's intricate structure and functional groups position it as a subject of interest in fields like medicinal chemistry, materials science, and organic synthesis.
Formula:C22H14INO6
InChI:InChI=1/C22H14INO6/c23-10-20(27)24-11-1-4-14-17(7-11)22(30-21(14)28)15-5-2-12(25)8-18(15)29-19-9-13(26)3-6-16(19)22/h1-9,25-26H,10H2,(H,24,27)
SMILES:c1cc2c(cc1N=C(CI)O)C1(c3ccc(cc3Oc3cc(ccc13)O)O)OC2=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6-Iodoacetamidofluorescein
CAS:6-Iodoacetamidofluorescein: SH-reactive dye for labeling nuclear proteins.Formula:C22H14INO6Color and Shape:SolidMolecular weight:515.25

