CAS 7327-99-3
:Methyl 4-oxo-2-butenoate
Description:
Methyl 4-oxo-2-butenoate, with the CAS number 7327-99-3, is an organic compound characterized by its ester functional group and a conjugated carbonyl system. It typically appears as a colorless to pale yellow liquid with a fruity odor. The molecular structure features a methyl ester group attached to a butenoate backbone, which contributes to its reactivity and potential applications in organic synthesis. This compound is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. It exhibits moderate polarity, making it soluble in organic solvents while having limited solubility in water. Methyl 4-oxo-2-butenoate can undergo various chemical reactions, including nucleophilic additions and polymerization, due to the presence of the carbonyl group. Safety data indicates that it should be handled with care, as it may be irritating to the skin and eyes. Proper storage in a cool, dry place away from light is recommended to maintain its stability and integrity.
Formula:C5H6O3
InChI:InChI=1S/C5H6O3/c1-8-5(7)3-2-4-6/h2-4H,1H3
InChI key:InChIKey=CRBJVPSOOMDSPT-UHFFFAOYSA-N
SMILES:C(C=CC=O)(OC)=O
Synonyms:- Methyl 4-oxo-2-butenoate
- 2-Butenoic acid, 4-oxo-, methyl ester
- Methyl 3-formylacrylate
- Methyl β-formylacrylate
- Malealdehydic acid, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
