CAS 73276-75-2
:ethyl 7-oxodecanoate
Description:
Ethyl 7-oxodecanoate, with the CAS number 73276-75-2, is an ester derived from the reaction of decanoic acid and ethanol. This compound features a carbonyl group (C=O) at the seventh carbon position of the decanoate chain, which contributes to its reactivity and potential applications in organic synthesis. Ethyl 7-oxodecanoate is typically a colorless to pale yellow liquid with a characteristic fruity odor, making it potentially useful in flavor and fragrance industries. Its molecular structure includes a long hydrophobic carbon chain, which influences its solubility properties, generally making it more soluble in organic solvents than in water. The presence of the carbonyl group also allows for various chemical transformations, such as reduction or condensation reactions. Ethyl 7-oxodecanoate may be utilized in the synthesis of more complex molecules, and its derivatives can be explored for biological activity, including potential applications in pharmaceuticals. As with many esters, it is important to handle this compound with care, observing appropriate safety protocols due to its potential irritant properties.
Formula:C12H22O3
InChI:InChI=1/C12H22O3/c1-3-8-11(13)9-6-5-7-10-12(14)15-4-2/h3-10H2,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.