CAS 73287-67-9
:4-Hydroxy-1-methyl-3-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]-2(1H)-quinolinone
Description:
4-Hydroxy-1-methyl-3-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]-2(1H)-quinolinone, with CAS number 73287-67-9, is a synthetic organic compound characterized by its complex azo structure, which includes multiple aromatic rings and functional groups. This compound features a quinolinone backbone, which contributes to its potential biological activity and photophysical properties. The presence of hydroxyl and methyl groups enhances its solubility and reactivity, while the azo linkages provide distinct chromophoric properties, making it useful in dye applications and as a potential indicator in various chemical analyses. Its azo groups can participate in various chemical reactions, including reduction and coupling reactions, which are significant in organic synthesis. Additionally, the compound may exhibit interesting optical properties, such as UV-Vis absorption, making it relevant in fields like materials science and photochemistry. Safety and handling precautions should be observed due to the potential toxicity associated with azo compounds. Overall, this substance represents a versatile chemical with applications in both research and industrial contexts.
Formula:C22H17N5O2
InChI:InChI=1S/C22H17N5O2/c1-27-19-10-6-5-9-18(19)21(28)20(22(27)29)26-25-17-13-11-16(12-14-17)24-23-15-7-3-2-4-8-15/h2-14,28H,1H3
InChI key:InChIKey=DPCODSAZAZCDLC-UHFFFAOYSA-N
SMILES:OC=1C=2C(N(C)C(=O)C1N=NC3=CC=C(N=NC4=CC=CC=C4)C=C3)=CC=CC2
Synonyms:- (3Z)-1-methyl-3-(2-{4-[(E)-phenyldiazenyl]phenyl}hydrazinylidene)quinoline-2,4(1H,3H)-dione
- 2(1H)-Quinolinone, 4-hydroxy-1-methyl-3-((4-(phenylazo)phenyl)azo)-
- 2(1H)-Quinolinone, 4-hydroxy-1-methyl-3-(2-(4-(2-phenyldiazenyl)phenyl)diazenyl)-
- 4-Hydroxy-1-methyl-3-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]-2(1H)-quinolinone
- Carbostyril, 4-hydroxy-1-methyl-3-[[p-(phenylazo)phenyl]azo]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Disperse Yellow 56-Methyl
CAS:Controlled ProductFormula:C22H17N5O2Color and Shape:NeatMolecular weight:383.40

