CAS 73289-74-4

α,2-Dihydroxy-3-methylbenzeneacetic acid

Description:

α,2-Dihydroxy-3-methylbenzeneacetic acid, also known as a derivative of phenolic compounds, is characterized by the presence of two hydroxyl groups and a methyl group attached to a benzene ring, along with an acetic acid moiety. This compound typically exhibits both acidic and phenolic properties, making it soluble in polar solvents. Its structure allows for potential hydrogen bonding, which can influence its reactivity and interactions with other molecules. The presence of the methyl group can affect the steric hindrance and electronic properties of the compound, potentially enhancing its biological activity. This substance may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential antioxidant and antimicrobial properties. Additionally, its unique functional groups may allow for further chemical modifications, making it a versatile intermediate in organic synthesis. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.

Formula: C₉H₁₀O₄

InChI: InChI=1S/C9H10O4/c1-5-3-2-4-6(7(5)10)8(11)9(12)13/h2-4,8,10-11H,1H3,(H,12,13)

InChI key: InChIKey=ZYCLPPCOEOASJI-UHFFFAOYSA-N

SMILES: C(C(O)=O)(O)C1=C(O)C(C)=CC=C1

Synonyms:

• Benzeneacetic acid, α,2-dihydroxy-3-methyl-
• 2-Hydroxy-2-(2-hydroxy-3-methylphenyl)acetic acid
• α,2-Dihydroxy-3-methylbenzeneacetic acid