CymitQuimica logo

CAS 73289-76-6

:

5-Chloro-α,2-dihydroxybenzeneacetic acid

Description:
5-Chloro-α,2-dihydroxybenzeneacetic acid, with the CAS number 73289-76-6, is an organic compound characterized by its aromatic structure and the presence of both chlorine and hydroxyl functional groups. This compound features a chlorinated benzene ring, which contributes to its reactivity and potential biological activity. The presence of two hydroxyl groups indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The carboxylic acid functional group in its structure suggests that it can act as an acid, capable of donating protons in solution. This compound may exhibit various properties such as antimicrobial or anti-inflammatory activities, making it of interest in pharmaceutical research. Additionally, its chlorinated nature may influence its environmental persistence and toxicity. Overall, 5-Chloro-α,2-dihydroxybenzeneacetic acid is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.
Formula:C8H7ClO4
InChI:InChI=1S/C8H7ClO4/c9-4-1-2-6(10)5(3-4)7(11)8(12)13/h1-3,7,10-11H,(H,12,13)
InChI key:InChIKey=GTNWAKLEMPDSQC-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=C(O)C=CC(Cl)=C1
Synonyms:
  • 2-(5-Chloro-2-hydroxyphenyl)-2-hydroxyacetic acid
  • 5-Chloro-α,2-dihydroxybenzeneacetic acid
  • Benzeneacetic acid, 5-chloro-α,2-dihydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.