CymitQuimica logo

CAS 73289-82-4

:

2-Formyl-6-hydroxybenzonitrile

Description:
2-Formyl-6-hydroxybenzonitrile, with the CAS number 73289-82-4, is an organic compound characterized by its aromatic structure, which includes a formyl group (-CHO) and a hydroxyl group (-OH) attached to a benzene ring that also contains a nitrile group (-C≡N). This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure suggests it may exhibit properties such as hydrogen bonding due to the hydroxyl group, which can influence its reactivity and interactions with other molecules. The presence of the nitrile group indicates potential for nucleophilic attack, making it a candidate for various chemical reactions, including condensation and substitution reactions. Additionally, the compound may have applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical entities. Its specific reactivity and applications would depend on the functional groups present and the conditions under which it is used.
Formula:C8H5NO2
InChI:InChI=1S/C8H5NO2/c9-4-7-6(5-10)2-1-3-8(7)11/h1-3,5,11H
InChI key:InChIKey=YEYAXXBUWPTNPN-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C#N)C(O)=CC=C1
Synonyms:
  • Benzonitrile, 2-formyl-6-hydroxy-
  • 2-Formyl-6-hydroxybenzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.