CAS 733-44-8: Tetraethylammonium p-toluenesulfonate
Description:Tetraethylammonium p-toluenesulfonate, with the CAS number 733-44-8, is an organic compound that serves as a quaternary ammonium salt. It is characterized by its structure, which consists of a tetraethylammonium cation and a p-toluenesulfonate anion. This compound is typically a white to off-white solid that is soluble in polar solvents such as water and alcohols, making it useful in various chemical applications. Tetraethylammonium p-toluenesulfonate is often employed as a phase transfer catalyst, facilitating the transfer of ions or molecules between different phases, particularly in organic synthesis. Additionally, it can act as a surfactant due to its amphiphilic nature, which allows it to interact with both hydrophilic and hydrophobic substances. The compound is generally stable under standard conditions but should be handled with care, as quaternary ammonium compounds can be toxic in high concentrations. Overall, its unique properties make it valuable in both laboratory and industrial settings.
Formula:C8H20N·C7H7O3S
InChI:InChI=1S/C8H20N.C7H8O3S/c1-5-9(6-2,7-3)8-4;1-6-2-4-7(5-3-6)11(8,9)10/h5-8H2,1-4H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1
InChI key:InChIKey=QKFFSWPNFCXGIQ-UHFFFAOYSA-M
SMILES:O=S(=O)([O-])C1=CC=C(C=C1)C.CC[N+](CC)(CC)CC
- Synonyms:
- Ammonium, tetraethyl-, p-toluenesulfonate
- Ethanaminium, N,N,N-triethyl-, 4-methylbenzenesulfonate (1:1)
- Ethanaminium, N,N,N-triethyl-, salt with 4-methylbenzenesulfonic acid (1:1)
- N,N,N-triethylethanaminium 4-methylbenzenesulfonate
- Tetraethylammonium Para-Toluenesulfonate
- Tetraethylammonium p-toluenesulphonate
- Tetraethylammonium p-tolylsulfonate
- Tetraethylammonium p-tosylate
- Tetraethylammonium toluenesulfonate
- Tetraethylammonium tosylate
- See more synonyms
- Tetraethylammoniumptoluenesulfonate
- Tetraethylammonium p-toluenesulfonate
