CAS 733002-61-4
:(3R,6R)-6-[7-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxo-quinoline-3-carbonyl]oxy-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid
Description:
The chemical substance with the name "(3R,6R)-6-[7-[(4aS,7aS)-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl]-1-cyclopropyl-6-fluoro-8-methoxy-4-oxo-quinoline-3-carbonyl]oxy-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid" and CAS number "733002-61-4" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl, carbonyl, and methoxy groups. This compound features a quinoline core, which is known for its biological activity, and a tetrahydropyran moiety that contributes to its stereochemistry and potential interactions in biological systems. The presence of fluorine and cyclopropyl groups suggests enhanced lipophilicity and possibly improved pharmacokinetic properties. Its stereochemistry, indicated by the (3R,6R) and (4aS,7aS) designations, implies specific three-dimensional arrangements that can significantly influence its biological activity and interactions with target proteins or enzymes. Overall, this compound may have potential applications in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways.
Formula:C27H32FN3O10
InChI:InChI=1/C27H32FN3O10/c1-39-23-17-13(7-15(28)18(23)30-8-11-3-2-6-29-16(11)10-30)19(32)14(9-31(17)12-4-5-12)26(38)41-27-22(35)20(33)21(34)24(40-27)25(36)37/h7,9,11-12,16,20-22,24,27,29,33-35H,2-6,8,10H2,1H3,(H,36,37)/t11-,16+,20?,21+,22?,24?,27+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Moxifloxacin Acyl Glucuronide
CAS:Formula:C27H32FN3O10Color and Shape:Off-White SolidMolecular weight:577.56rac cis-Moxifloxacin Acyl-b-D-glucuronide (>85%)
CAS:Controlled ProductApplications A metabolite of Moxifloxacin (M745000).
References Steinijans, V., et al.: J. Clin. Pharmacol. Ther., 29, 323 (1991), Haria, M., et al.: Drugs, 51, 585 (1996), Pickerill, K., et al.: Pharmacotherapy, 20, 417(2000),Formula:C27H32FN3O10Purity:>85%Color and Shape:NeatMolecular weight:577.56rac cis-Moxifloxacin-d4 Acyl-β-D-glucuronide
CAS:Controlled ProductApplications A labelled metabolite of Moxifloxacin (M745000).
References Steinijans, V., et al.: J. Clin. Pharmacol. Ther., 29, 323 (1991), Haria, M., et al.: Drugs, 51, 585 (1996), Pickerill, K., et al.: Pharmacotherapy, 20, 417(2000),Formula:C27H28D4FN3O10Color and Shape:NeatMolecular weight:581.58rac cis-Moxifloxacin acyl-b-D-glucuronide
CAS:Moxifloxacin is a fluoroquinolone antibiotic that inhibits bacterial DNA gyrase and topoisomerase IV, which are enzymes that maintain the integrity of bacterial DNA. Moxifloxacin forms an acyl-b-D-glucuronide metabolite (rac) which has a lower risk of drug resistance than moxifloxacin itself. Rac-moxifloxacin acyl-b-D-glucuronide also has a higher affinity for bacterial 16S ribosomal RNA, leading to better inhibition of protein synthesis and cell death. This drug is synthesized by modification of sugar moieties on the racemic compound with glycals to form oligosaccharides and polysaccharides. It is then methylated with a methyl group from S-adenosyl methionine (SAM). The resulting product is purified by crystallization or column chromatography to remove impurities. Rac cisFormula:C27H32FN3O10Purity:Min. 95%Color and Shape:SolidMolecular weight:577.56 g/mol



