
CAS 733030-48-3
:5-(4-Bromophenyl)-2-(chloromethyl)thieno[2,3-d]pyrimidin-4(1H)-one
Description:
5-(4-Bromophenyl)-2-(chloromethyl)thieno[2,3-d]pyrimidin-4(1H)-one is a heterocyclic organic compound characterized by its complex structure, which includes a thieno[2,3-d]pyrimidine core. This compound features a bromophenyl group and a chloromethyl substituent, contributing to its unique chemical properties. The presence of halogen atoms (bromine and chlorine) often enhances the compound's reactivity, making it of interest in medicinal chemistry and material science. The thieno[2,3-d]pyrimidine framework is known for its biological activity, including potential applications in pharmaceuticals, particularly as anti-cancer or anti-inflammatory agents. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, influenced by the electron-withdrawing effects of the halogen substituents. Additionally, its solubility and stability can vary based on the solvent and environmental conditions, which are crucial for its practical applications. Overall, this compound represents a significant area of interest for researchers exploring novel therapeutic agents.
Formula:C13H8BrClN2OS
InChI:InChI=1S/C13H8BrClN2OS/c14-8-3-1-7(2-4-8)9-6-19-13-11(9)12(18)16-10(5-15)17-13/h1-4,6H,5H2,(H,16,17,18)
InChI key:InChIKey=GNYVDNGHQNRGLG-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CSC2NC(CCl)=N1)C3=CC=C(Br)C=C3
Synonyms:- Thieno[2,3-d]pyrimidin-4(1H)-one, 5-(4-bromophenyl)-2-(chloromethyl)-
- 5-(4-Bromophenyl)-2-(chloromethyl)thieno[2,3-d]pyrimidin-4(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.