CAS 733030-86-9

3-Amino-N,N-diethyl-4-[4-(2-methoxyphenyl)-1-piperazinyl]benzenesulfonamide

Description:

3-Amino-N,N-diethyl-4-[4-(2-methoxyphenyl)-1-piperazinyl]benzenesulfonamide is a chemical compound characterized by its complex structure, which includes an amino group, sulfonamide functionality, and a piperazine ring. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, though its specific biological activity may vary based on its structural components. The presence of the diethyl group and the methoxyphenyl moiety suggests that it may have lipophilic characteristics, potentially influencing its solubility and permeability in biological systems. The piperazine ring is often associated with psychoactive properties, indicating that this compound may have applications in pharmacology, particularly in the development of therapeutic agents targeting the central nervous system. Additionally, the compound's molecular interactions could be influenced by hydrogen bonding and steric effects due to its substituents. Overall, this compound represents a unique combination of functional groups that may contribute to its biological activity and potential applications in medicinal chemistry.

Formula: C₂₁H₃₀N₄O₃S

InChI: InChI=1S/C21H30N4O3S/c1-4-25(5-2)29(26,27)17-10-11-19(18(22)16-17)23-12-14-24(15-13-23)20-8-6-7-9-21(20)28-3/h6-11,16H,4-5,12-15,22H2,1-3H3

InChI key: InChIKey=JHLQDOPYNDWWEY-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC=C1)N2CCN(CC2)C3=C(N)C=C(S(N(CC)CC)(=O)=O)C=C3

Synonyms:

• Benzenesulfonamide, 3-amino-N,N-diethyl-4-[4-(2-methoxyphenyl)-1-piperazinyl]-
• 3-Amino-N,N-diethyl-4-[4-(2-methoxyphenyl)-1-piperazinyl]benzenesulfonamide