CAS 733030-99-4

6-Chloro-3-(2,4-difluorophenyl)-2,3-dihydro-2-thioxo-4(1H)-quinazolinone

Description:

6-Chloro-3-(2,4-difluorophenyl)-2,3-dihydro-2-thioxo-4(1H)-quinazolinone is a synthetic organic compound characterized by its quinazolinone core structure, which features a thioxo group and a chloro substituent. The presence of the 2,4-difluorophenyl group enhances its potential biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate to high lipophilicity due to the aromatic fluorinated substituents, which can influence its solubility and permeability in biological systems. The thioxo group may contribute to its reactivity and interaction with biological targets. Additionally, the chlorine atom can affect the compound's electronic properties and steric hindrance. Overall, this compound may possess pharmacological properties, potentially acting as an inhibitor or modulator in various biochemical pathways, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups.

Formula: C₁₄H₇ClF₂N₂OS

InChI: InChI=1S/C14H7ClF2N2OS/c15-7-1-3-11-9(5-7)13(20)19(14(21)18-11)12-4-2-8(16)6-10(12)17/h1-6H,(H,18,21)

InChI key: InChIKey=HPPVPBXAAJTMNK-UHFFFAOYSA-N

SMILES: O=C1N(C(=S)NC=2C1=CC(Cl)=CC2)C3=C(F)C=C(F)C=C3

Synonyms:

• 6-Chloro-3-(2,4-difluorophenyl)-2,3-dihydro-2-thioxo-4(1H)-quinazolinone
• 4(1H)-Quinazolinone, 6-chloro-3-(2,4-difluorophenyl)-2,3-dihydro-2-thioxo-