CAS 733031-17-9

4-Acetyl-N-butylbenzenesulfonamide

Description:

4-Acetyl-N-butylbenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a butyl group attached to the nitrogen atom of the sulfonamide, contributing to its hydrophobic characteristics. The presence of the acetyl group enhances its reactivity and solubility in organic solvents. Structurally, it consists of a benzene ring substituted with both an acetyl group and a sulfonamide moiety, which can influence its biological activity and potential applications in pharmaceuticals. The compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its solubility can vary depending on the solvent, and it may participate in various chemical reactions, including acylation and sulfonation. As with many sulfonamides, it may also exhibit antimicrobial properties, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₂H₁₇NO₃S

InChI: InChI=1S/C12H17NO3S/c1-3-4-9-13-17(15,16)12-7-5-11(6-8-12)10(2)14/h5-8,13H,3-4,9H2,1-2H3

InChI key: InChIKey=XRIBAEPEBGCNFE-UHFFFAOYSA-N

SMILES: S(NCCCC)(=O)(=O)C1=CC=C(C(C)=O)C=C1

Synonyms:

• Benzenesulfonamide, 4-acetyl-N-butyl-
• 4-Acetyl-N-butylbenzenesulfonamide

4-Acetyl-N-butylbenzene-1-sulfonamide

CAS: 733031-17-9

Versatile small molecule scaffold

Formula: C₁₂H₁₇NO₃S

Purity: Min. 95%

Molecular weight: 255.34 g/mol

Ref: 3D-IEB03117