CymitQuimica logo

CAS 73305-13-2

:

N-(2,4-Dichlorophenyl)hydrazinecarbothioamide

Description:
N-(2,4-Dichlorophenyl)hydrazinecarbothioamide is an organic compound characterized by its hydrazine and thioamide functional groups. It features a dichlorophenyl moiety, which contributes to its chemical reactivity and potential biological activity. The presence of the hydrazine group indicates that it may participate in various chemical reactions, including oxidation and condensation reactions. The thioamide functional group can enhance its reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit properties such as moderate solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals due to its structural characteristics. Additionally, the dichlorophenyl group may impart specific electronic properties, influencing the compound's interaction with biological targets. Safety and handling precautions are essential, as compounds containing halogens and nitrogen functionalities can pose health risks. Overall, N-(2,4-Dichlorophenyl)hydrazinecarbothioamide is a compound of interest in synthetic chemistry and may have implications in various fields, including medicinal chemistry and material science.
Formula:C7H7Cl2N3S
InChI:InChI=1S/C7H7Cl2N3S/c8-4-1-2-6(5(9)3-4)11-7(13)12-10/h1-3H,10H2,(H2,11,12,13)
InChI key:InChIKey=PEWKSNLNCRYBNV-UHFFFAOYSA-N
SMILES:N(C(NN)=S)C1=C(Cl)C=C(Cl)C=C1
Synonyms:
  • 4-(2,4-Dichlorophenyl)thiosemicarbazide
  • N-(2,4-Dichlorophenyl)hydrazinecarbothioamide
  • Hydrazinecarbothioamide, N-(2,4-dichlorophenyl)-
  • 4-(2,4-Dichlorophenyl)-3-thiosemicarbazide
  • 1-Amino-3-(2,4-dichlorophenyl)thiourea
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.