CymitQuimica logo

CAS 733054-10-9

:

2-fluoroindolizine-3-carbonitrile

Description:
2-Fluoroindolizine-3-carbonitrile is a heterocyclic organic compound characterized by its indolizine structure, which features a five-membered ring containing nitrogen. The presence of a fluorine atom at the second position of the indolizine ring and a cyano group (-C≡N) at the third position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential reactivity due to the electron-withdrawing nature of the cyano group and the electronegative fluorine atom, which can influence its behavior in chemical reactions, such as nucleophilic substitutions or electrophilic additions. Additionally, 2-fluoroindolizine-3-carbonitrile may possess interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and reactivity can vary based on the functional groups present and the overall molecular framework, highlighting the importance of structure in determining chemical behavior.
Formula:C9H5FN2
InChI:InChI=1/C9H5FN2/c10-8-5-7-3-1-2-4-12(7)9(8)6-11/h1-5H
SMILES:c1ccn2c(c1)cc(c2C#N)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.