CAS 73318-02-2
:2,2'-(2,5-difluorocyclohexa-2,5-diene-1,4-diylidene)dipropanedinitrile
Description:
2,2'-(2,5-Difluorocyclohexa-2,5-diene-1,4-diylidene)dipropanedinitrile, identified by CAS number 73318-02-2, is a synthetic organic compound characterized by its unique structure that includes a cyclohexadiene core and two propanedinitrile functional groups. This compound features two fluorine atoms, which can influence its reactivity and physical properties, such as polarity and solubility. Typically, compounds of this nature exhibit significant stability under standard conditions but may undergo reactions such as nucleophilic addition or substitution due to the presence of the nitrile groups. The presence of the diene system suggests potential for participation in Diels-Alder reactions or other cycloaddition processes. Additionally, the compound's molecular structure may impart interesting electronic properties, making it a candidate for applications in materials science or organic electronics. However, specific data regarding its melting point, boiling point, and solubility would require empirical measurement or detailed literature review for precise characterization.
Formula:C12H2F2N4
InChI:InChI=1/C12H2F2N4/c13-11-1-9(7(3-15)4-16)12(14)2-10(11)8(5-17)6-18/h1-2H
SMILES:c1c(=C(C#N)C#N)c(cc(=C(C#N)C#N)c1F)F
Synonyms:- 2,2'-(2,5-Difluorocyclohexa-2,5-diene-1,4-diylidene)dimalononitrile
- Propanedinitrile, 2,2'-(2,5-Difluoro-2,5-Cyclohexadiene-1,4-Diylidene)Bis-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,5-Difluoro-7,7,8,8-tetracyanoquinodimethane
CAS:Formula:C12H2F2N4Purity:>98.0%(N)Color and Shape:White to Brown powder to crystalMolecular weight:240.172,5-DIFLUORO-7,7,8,8-TETRACYANOQUINODIMETHANE
CAS:Formula:C12H2F2N4Purity:98%Color and Shape:SolidMolecular weight:240.16792,5-Difluoro-7,7,8,8-tetracyanoquinodimethane
CAS:2,5-Difluoro-7,7,8,8-tetracyanoquinodimethane is a donor molecule that has an acceptor property. It can be used in the fabrication of organic light emitting devices. 2,5-Difluoro-7,7,8,8-tetracyanoquinodimethane is a molecule with a molecular structure that consists of two benzene rings and two quinonediimide groups. The molecule has a fluorine atom at position 5 and another fluorine atom at position 8. This molecule has been shown to have good transport properties and to emit light when irradiated with UV radiation.Formula:C12H2F2N4Purity:Min. 95%Color and Shape:PowderMolecular weight:240.17 g/mol



