CAS 73318-76-0

6-Methoxy-4,5-pyrimidinediamine

Description:

6-Methoxy-4,5-pyrimidinediamine, with the CAS number 73318-76-0, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. This compound features two amino groups (-NH2) at the 4 and 5 positions of the pyrimidine ring, contributing to its potential as a building block in pharmaceuticals and agrochemicals. The presence of a methoxy group (-OCH3) at the 6 position enhances its solubility and reactivity, making it useful in various chemical reactions. The compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions. Due to its functional groups, 6-Methoxy-4,5-pyrimidinediamine may participate in hydrogen bonding, influencing its interactions in biological systems and its potential applications in medicinal chemistry. Safety data and handling precautions should be consulted, as with any chemical substance.

Formula: C₅H₈N₄O

InChI: InChI=1S/C5H8N4O/c1-10-5-3(6)4(7)8-2-9-5/h2H,6H2,1H3,(H2,7,8,9)

InChI key: InChIKey=CZXSGCAOFKYSNR-UHFFFAOYSA-N

SMILES: O(C)C=1C(N)=C(N)N=CN1

Synonyms:

• 6-Methoxy-4,5-pyrimidinediamine
• 4,5-Pyrimidinediamine, 6-methoxy-