CAS 7332-93-6
:2-Oxopentanal
Description:
2-Oxopentanal, also known as 2-oxopentanal or 2-oxopentanal, is an organic compound characterized by its aldehyde functional group and a ketone group, making it a member of the α-keto aldehyde family. Its molecular formula is C5H8O2, indicating it contains five carbon atoms, eight hydrogen atoms, and two oxygen atoms. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in water and organic solvents, which enhances its utility in various chemical reactions. 2-Oxopentanal is known for its reactivity, particularly in condensation reactions and as an intermediate in the synthesis of more complex organic molecules. Its structure allows it to participate in various chemical transformations, making it valuable in organic synthesis and potentially in the development of pharmaceuticals. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C5H8O2
InChI:InChI=1S/C5H8O2/c1-2-3-5(7)4-6/h4H,2-3H2,1H3
InChI key:InChIKey=GDTHVMAIBQVUMV-UHFFFAOYSA-N
SMILES:C(CCC)(C=O)=O
Synonyms:- .alpha.-Ketopentanal
- 2-Ketopentanal
- Pentanal, 2-oxo-
- Propylglyoxal
- Valeraldehyde, 2-oxo-
- α-Ketopentanal
- 2-Oxopentanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
