CAS 73323-68-9

N-(3-Oxopropyl)acetamide

Description:

N-(3-Oxopropyl)acetamide, with the CAS number 73323-68-9, is an organic compound characterized by its amide functional group. It features a propanoyl moiety attached to an acetamide structure, indicating that it contains both ketone and amide functionalities. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents such as water and alcohols, which is common for amides due to their ability to form hydrogen bonds. N-(3-Oxopropyl)acetamide may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its reactivity can be influenced by the presence of the carbonyl groups, allowing for potential applications in organic synthesis and medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, N-(3-Oxopropyl)acetamide represents a versatile compound with potential utility in various chemical applications.

Formula: C₅H₉NO₂

InChI: InChI=1S/C5H9NO2/c1-5(8)6-3-2-4-7/h4H,2-3H2,1H3,(H,6,8)

InChI key: InChIKey=ARJPPNFIEQKVBB-UHFFFAOYSA-N

SMILES: N(CCC=O)C(C)=O

Synonyms:

• 3-Acetamidopropanal
• N-(3-Oxopropyl)acetamide
• Acetamide, N-(3-oxopropyl)-