CAS 73324-20-6
:Propanoic acid, 2-hydroxy-, calcium salt (6:1)
Description:
Propanoic acid, 2-hydroxy-, calcium salt (6:1), also known as calcium 2-hydroxypropanoate, is a calcium salt derived from propanoic acid, which features a hydroxyl group on the second carbon. This compound typically appears as a white to off-white powder and is soluble in water, making it useful in various applications. It is characterized by its ability to act as a buffering agent and is often utilized in food and pharmaceutical formulations due to its mild acidity and potential preservative properties. The calcium salt form enhances its stability and bioavailability, making it suitable for dietary supplements and fortification. Additionally, it may exhibit antimicrobial properties, contributing to its use in food preservation. As with many calcium salts, it is generally regarded as safe for consumption, although specific regulatory guidelines should be followed. Overall, this compound plays a significant role in both industrial and nutritional contexts, reflecting its versatility and functional benefits.
Formula:C3H6O3Ca
InChI:InChI=1S/C3H6O3.Ca/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);
InChI key:InChIKey=SMHNUIFHMAGAFL-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C)O.[Ca]
Synonyms:- Propanoic acid, 2-hydroxy-, calcium salt (6:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
