CAS 73325-61-8
:N-(Phenylmethyl)-2-thiophenemethanamine
Description:
N-(Phenylmethyl)-2-thiophenemethanamine, also known by its CAS number 73325-61-8, is an organic compound characterized by the presence of both a thiophene ring and an amine functional group. This compound features a phenylmethyl group (benzyl group) attached to a thiophene ring at the 2-position, along with an amine group that contributes to its basicity and potential reactivity. The thiophene moiety imparts aromatic properties, while the amine group can participate in hydrogen bonding and nucleophilic reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can be influenced by the presence of the thiophene and amine groups, which may also affect its interactions with other molecules. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C12H13NS
InChI:InChI=1S/C12H13NS/c1-2-5-11(6-3-1)9-13-10-12-7-4-8-14-12/h1-8,13H,9-10H2
InChI key:InChIKey=GEWKIDGKZRKUFB-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CC=C1)C2=CC=CS2
Synonyms:- N-(Phenylmethyl)-2-thiophenemethanamine
- 1-Phenyl-N-(thiophen-2-ylmethyl)methanamine
- 2-Thiophenemethanamine, N-(phenylmethyl)-
- 1-Phenyl-N-(2-thienylmethyl)methanamine
- N-Benzyl-1-(thiophen-2-yl)MethanaMine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
