CymitQuimica logo

CAS 73328-60-6

:

N-(1-benzylpyrrolidin-3-yl)-5-chloro-2-methoxy-4-(methylamino)benzamide

Description:
N-(1-benzylpyrrolidin-3-yl)-5-chloro-2-methoxy-4-(methylamino)benzamide, with the CAS number 73328-60-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzamide core substituted with various functional groups. The presence of a chloro group and a methoxy group on the aromatic ring contributes to its chemical reactivity and potential biological activity. The pyrrolidine moiety, particularly when substituted with a benzyl group, suggests possible interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as lipophilicity due to the aromatic and aliphatic components, which can influence its solubility and permeability in biological systems. Additionally, the methylamino group may enhance its pharmacological profile. Overall, the unique combination of functional groups in this compound suggests potential applications in drug development, although specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C20H24ClN3O2
InChI:InChI=1/C20H24ClN3O2/c1-22-18-11-19(26-2)16(10-17(18)21)20(25)23-15-8-9-24(13-15)12-14-6-4-3-5-7-14/h3-7,10-11,15,22H,8-9,12-13H2,1-2H3,(H,23,25)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.