CAS 73335-78-1
:4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-bromo-3,3-dimethyl-7-oxo-, sodium salt, [2S-(2α,5α,6β)]-
Description:
4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-bromo-3,3-dimethyl-7-oxo-, sodium salt, [2S-(2α,5α,6β)]- is a complex organic compound characterized by its bicyclic structure, which includes a sulfur atom (thia) and a nitrogen atom (azabicyclo). This compound features a carboxylic acid functional group, contributing to its acidic properties, and a sodium salt form, indicating it is soluble in water and can dissociate into sodium ions and the corresponding anion in solution. The presence of a bromo substituent and a ketone group (7-oxo) suggests potential reactivity and biological activity, making it of interest in medicinal chemistry. The stereochemistry indicated by the [2S-(2α,5α,6β)] notation implies specific spatial arrangements of the atoms, which can influence the compound's interactions with biological targets. Overall, this compound's unique structural features and functional groups may contribute to its potential applications in pharmaceuticals or as a biochemical tool.
Formula:C8H10BrNO3S·Na
InChI:InChI=1S/C8H10BrNO3S.Na/c1-8(2)4(7(12)13)10-5(11)3(9)6(10)14-8;/h3-4,6H,1-2H3,(H,12,13);/t3-,4+,6-;/m1./s1
InChI key:InChIKey=UWLFRMZPLQJGNF-ZXSAOVMCSA-N
SMILES:C(O)(=O)[C@@H]1N2[C@@]([C@H](Br)C2=O)(SC1(C)C)[H].[Na]
Synonyms:- 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-bromo-3,3-dimethyl-7-oxo-, sodium salt, [2S-(2α,5α,6β)]-
- Sodium (2S-(2alpha,5alpha,6beta))-6-bromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo(3.2.0)heptane-2-carboxylate
- Sodium 6β-bromopenicillanate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Brobactam Sodium Salt
CAS:Controlled ProductStability Hygroscopic
Applications Brobactam is a potent semi-synthetic β-lactamase inhibitor as well as an impurity of Sulbactam (S699185).
References Melchior, N.H. et al.: Proc. Int. Congr. Chemother., 3, 55 (1983);Formula:C8H9BrNNaO3SColor and Shape:NeatMolecular weight:302.12Brobactam sodium
CAS:Brobactam sodium is a β-lactamase inhibitor, which is a chemically synthesized compound with the primary function of inactivating β-lactamase enzymes produced by certain bacteria. These enzymes can degrade β-lactam antibiotics, such as penicillins and cephalosporins, rendering them ineffective. Brobactam sodium functions by forming a covalent bond with the active site of β-lactamase enzymes, thus inhibiting their activity and allowing the concomitantly administered β-lactam antibiotic to exert its bactericidal effect on the susceptible pathogens.Formula:C8H9BrNNaO3SPurity:Min. 95%Molecular weight:302.12 g/molBrobactam Sodium Salt
CAS:Brobactam Sodium Salt is a β-lactamase inhibitor.Formula:C8H9BrNNaO3SColor and Shape:SolidMolecular weight:302.12


