CAS 73341-71-6
:Oudemansin
Description:
Oudemansin is a natural compound classified as a polyketide, primarily derived from certain fungal species, particularly those in the genus Oudemansiella. It is known for its complex structure, which includes multiple functional groups that contribute to its biological activity. Oudemansin exhibits antimicrobial properties, making it of interest in pharmaceutical research for potential therapeutic applications. The compound has been studied for its effects on various microorganisms, and its unique chemical structure may offer insights into the development of new antibiotics. Additionally, Oudemansin's solubility and stability in different solvents can vary, influencing its extraction and application in laboratory settings. As with many natural products, the study of Oudemansin also involves exploring its biosynthetic pathways and the ecological roles it plays within its native habitat. Overall, Oudemansin represents a fascinating subject of study within the field of natural products chemistry and pharmacology.
Formula:C17H22O4
InChI:InChI=1S/C17H22O4/c1-13(15(12-19-2)17(18)21-4)16(20-3)11-10-14-8-6-5-7-9-14/h5-13,16H,1-4H3/b11-10+,15-12+/t13-,16-/m0/s1
InChI key:InChIKey=COBDENJOXQSLKO-NKAAJRRHSA-N
SMILES:C(\[C@@H]([C@H](/C=C/C1=CC=CC=C1)OC)C)(/C(OC)=O)=C\OC
Synonyms:- 5-Hexenoic acid, 4-methoxy-2-(methoxymethylene)-3-methyl-6-phenyl-, methyl ester, [S-[R*,R*-(E,E)]]-
- (-)-Odemasin A
- Oudemansin A
- 5-Hexenoic acid, 4-methoxy-2-(methoxymethylene)-3-methyl-6-phenyl-, methyl ester, (2E,3S,4S,5E)-
- Oudemansin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Oudemansin A
CAS:Oudemansin A is an antibiotic that targets fungi, inhibiting the synthesis of proteins, RNA, and DNA.Formula:C17H22O4Color and Shape:SolidMolecular weight:290.35
