CAS 73342-16-2
:Poly(oxy-1,2-ethanediyl), α-(2-azidoethyl)-ω-hydroxy-
Description:
Poly(oxy-1,2-ethanediyl), α-(2-azidoethyl)-ω-hydroxy- is a polymer characterized by its polyether backbone, which is derived from ethylene oxide. This compound features azido groups, which are reactive functional groups containing nitrogen, making it useful in various chemical reactions, particularly in click chemistry and bioconjugation applications. The presence of the hydroxyl group at one end of the polymer provides a site for further functionalization or cross-linking, enhancing its versatility in material science and biomedical applications. The polymer's structure allows for good solubility in polar solvents, and its properties can be tailored by adjusting the molecular weight and the degree of polymerization. Additionally, the azido functionality can facilitate the introduction of other chemical entities, making it a valuable intermediate in the synthesis of more complex materials. Overall, this compound is significant in fields such as drug delivery, surface modification, and the development of smart materials due to its unique chemical properties.
Formula:(C2H4O)nC2H5N3O
InChI:InChI=1S/C4H9N3O2/c5-7-6-1-3-9-4-2-8/h8H,1-4H2
InChI key:InChIKey=CGJFKQFYZOARRV-UHFFFAOYSA-N
SMILES:C(CN=[N+]=[N-])OCCO
Synonyms:- N3-PEG-OH
- Poly(oxy-1,2-ethanediyl), α-(2-azidoethyl)-ω-hydroxy-
- Polyethylene glycol monoazide
- Polyethylene glycol mono(2-azidoethyl ether)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N3-PEGn-OH 2K, 5K, 10K, 20K
CAS:Formula:C48H97N3O24Purity:98%Color and Shape:SolidMolecular weight:1100.2895Azido-PEG24-alcohol
CAS:Azido-PEG24-alcoholFormula:C48H97N3O24Purity:95% (nmr) (Typical Value in Batch COA)Color and Shape: yellowish pastey solidMolecular weight:1,100.29g/molAzide-PEG12-alcohol
CAS:Azide-PEG12-alcoholFormula:C24H49N3O12Purity:98% (Typical Value in Batch COA)Color and Shape: low-melting solidMolecular weight:571.66g/molm-dPEG®36-Azide (Azido-m-dPEG®36)
CAS:m-dPEG®36-Azide (Azido-m-dPEG®36) is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. m-dPEG®36-Azide (Azido-m-dPEG®36) is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.Formula:C48H97N3O24Purity:Min. 95%Molecular weight:1,100.29 g/molAzido-dPEG®24-Alcohol
CAS:Azido-dPEG®24-Alcohol is a PEG polymer categorised as monofunctional (OH-PEG-X). Used as a linker, azido-dPEG®24-Alcohol is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.Purity:Min. 95%Molecular weight:1,100.29 g/molm-dPEG®4-Azide (Azido-m-dPEG®4)
CAS:m-dPEG®4-Azide (Azido-m-dPEG®4) is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. m-dPEG®4-Azide (Azido-m-dPEG®4) is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.
Formula:C72H145N3O36Purity:Min. 95%Molecular weight:1,628.92 g/molAzido-dPEG®36-Alcohol
CAS:Azido-dPEG®36-Alcohol is a PEG polymer categorised as monofunctional (OH-PEG-X). Used as a linker, azido-dPEG®36-Alcohol is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.
Purity:Min. 95%Molecular weight:1,628.92 g/mol


