CAS 73343-42-7

2-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-3-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one

Description:

The chemical substance known as 2-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-3-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one, with the CAS number 73343-42-7, is a flavonoid compound characterized by its complex polyphenolic structure. It features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of the benzopyran moiety indicates that it belongs to the flavonoid class, which is known for various biological activities, including anti-inflammatory, antimicrobial, and anticancer effects. The specific arrangement of hydroxyl groups and the side chain containing a 3-methyl-2-buten-1-yl group may influence its solubility, stability, and reactivity. This compound is of interest in pharmacological research due to its potential health benefits and applications in natural product chemistry. Its structural features suggest that it may interact with various biological targets, making it a candidate for further studies in medicinal chemistry and natural product development.

Formula: C₂₀H₁₈O₆

InChI: InChI=1S/C20H18O6/c1-10(2)3-5-14-19(25)18-16(24)8-12(22)9-17(18)26-20(14)13-6-4-11(21)7-15(13)23/h3-4,6-9,21-24H,5H2,1-2H3

InChI key: InChIKey=KEIIIPKLVSSAEI-UHFFFAOYSA-N

SMILES: C(C=C(C)C)C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=C(O)C=C(O)C=C3

Synonyms:

• 4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-3-(3-methyl-2-buten-1-yl)-
• 2-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-3-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-3-(3-methyl-2-butenyl)-
• 2-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-3-(3-methylbut-2-enyl)chromen-4-one
• Albanin A

Albanin A

CAS: 73343-42-7

Formula: C₂₀H₁₈O₆

Purity: 95%~99%

Molecular weight: 354.358

Ref: BP-BPF2325

Albanin A

CAS: 73343-42-7

Albanin A is a bioactive compound, which is derived from certain species of bacteria. These bacteria, typically isolated from environmental samples, produce Albanin A as part of their secondary metabolite profile. The mode of action of Albanin A involves the inhibition of key bacterial enzymes responsible for cell wall synthesis, effectively disrupting bacterial growth and reproduction. This makes it a potent antibacterial agent.

Formula: C₂₀H₁₈O₆

Purity: Min. 95%

Molecular weight: 354.40 g/mol

Ref: 3D-YCA34342