CAS 73349-07-2
:(R)-Methyl 2-hydroxybutanoate
Description:
(R)-Methyl 2-hydroxybutanoate, with the CAS number 73349-07-2, is an organic compound characterized by its chiral structure, which includes a hydroxyl group (-OH) and a methyl ester functional group. This compound is a derivative of 2-hydroxybutanoic acid and is known for its role in various chemical syntheses and applications in the flavor and fragrance industry due to its pleasant odor. It typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, such as esterification and oxidation. Additionally, the chirality of (R)-Methyl 2-hydroxybutanoate can influence its biological activity, making it of interest in pharmaceutical applications. Its physical properties, such as boiling point and density, can vary based on environmental conditions and purity. Overall, this compound is significant in both synthetic organic chemistry and potential applications in biochemistry.
Formula:C5H10O3
InChI:InChI=1/C5H10O3/c1-3-4(6)5(7)8-2/h4,6H,3H2,1-2H3/t4-/m0/s1
SMILES:CC[C@@H](C(=O)OC)O
Synonyms:- butanoic acid, 2-hydroxy-, methyl ester, (2S)-
- Methyl (2S)-2-hydroxybutanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(R)-Methyl 2-hydroxybutanoate
CAS:Formula:C5H10O3Purity:95%Color and Shape:LiquidMolecular weight:118.1311(R)-Methyl 2-hydroxybutanoate
CAS:<p>(R)-Methyl 2-hydroxybutanoate</p>Purity:95%Molecular weight:118.13g/mol(R)-Methyl 2-hydroxybutanoate
CAS:<p>(R)-Methyl 2-hydroxybutanoate is a synthetic chemical that is used in the esterification reaction to produce methyl esters and as an industrial solvent. This chemical can be synthesized by the reaction of (R)-methyl acetoacetate and hydrochloric acid. The technique for this chemical is a two-step process, which includes hydroxylation followed by hydrogenolysis. The yield rate for this chemical is about 98%.</p>Formula:C5H10O3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:118.13 g/mol
