CAS 73349-08-3
:Methyl (2S)-2-hydroxybutanoate
Description:
Methyl (2S)-2-hydroxybutanoate, with the CAS number 73349-08-3, is an organic compound characterized by its ester functional group and a chiral center at the second carbon atom. This compound is a methyl ester of 2-hydroxybutanoic acid, which means it is derived from the reaction of 2-hydroxybutanoic acid with methanol. It typically appears as a colorless to pale yellow liquid with a fruity odor, indicative of its ester nature. Methyl (2S)-2-hydroxybutanoate is soluble in organic solvents and exhibits moderate solubility in water due to the presence of the hydroxyl group. Its chirality gives rise to specific optical activity, making it relevant in various applications, including flavoring and fragrance industries, as well as in the synthesis of pharmaceuticals. Additionally, it may participate in various chemical reactions, such as esterification and transesterification, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C5H10O3
InChI:InChI=1S/C5H10O3/c1-3-4(6)5(7)8-2/h4,6H,3H2,1-2H3/t4-/m0/s1
InChI key:InChIKey=DDMCDMDOHABRHD-BYPYZUCNSA-N
SMILES:[C@@H](C(OC)=O)(CC)O
Synonyms:- (S)-2-Hydroxybutyric acid methyl ester
- Butanoic acid, 2-hydroxy-, methyl ester, (2S)-
- Butanoic acid, 2-hydroxy-, methyl ester, (S)-
- Methyl (2R)-2-hydroxybutanoate
- Methyl (2S)-2-hydroxybutanoate
- Methyl (2S)-hydroxybutyrate
- Methyl (S)-β-hydroxybutyrate
- butanoic acid, 2-hydroxy-, methyl ester, (2R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl (S)-2-hydroxybutanoate
CAS:Methyl (S)-2-hydroxybutanoateFormula:C5H10O3Purity:98%Molecular weight:118.13(S)-Methyl 2-hydroxybutanoate
CAS:Formula:C5H10O3Purity:98%Color and Shape:LiquidMolecular weight:118.1311Methyl (S)-2-hydroxybutanoate
CAS:Methyl (S)-2-hydroxybutanoateFormula:C5H10O3Purity:98%Molecular weight:118.13(S)-Methyl 2-hydroxybutanoate
CAS:Formula:C5H10O3Purity:98%Color and Shape:LiquidMolecular weight:118.132(S)-Methyl-2-hydroxybutanoate
CAS:(S)-Methyl-2-hydroxybutanoate is a synthetic chemical that is used in the industrial process of esterification. It is a hydroxylation product of acid methyl ester and has been shown to have an acid methyl ester as an intermediate during its synthesis. (S)-Methyl-2-hydroxybutanoate can be synthesized by reacting acetone and methanol with sulfuric acid in the presence of pyridine. The technique used for this reaction involves heating the reaction mixture to reflux conditions for 2 hours and then allowing it to cool to room temperature. The yield rate of this chemical is approximately 97%.Formula:C5H10O3Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:118.13 g/molRef: 3D-FM71684
Discontinued product




