CymitQuimica logo

CAS 7335-04-8

:

1-cyclopentylpiperidine

Description:
1-Cyclopentylpiperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, substituted with a cyclopentyl group. This compound has a molecular formula that reflects its structure, comprising carbon, hydrogen, and nitrogen atoms. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. 1-Cyclopentylpiperidine is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. The compound exhibits basic properties, as the nitrogen atom in the piperidine ring can accept protons, making it a weak base. Its solubility characteristics can vary, but it is generally soluble in organic solvents. Additionally, 1-cyclopentylpiperidine may possess psychoactive properties, which have been the subject of research in the context of neuropharmacology. Safety and handling precautions are essential when working with this compound, as with many organic chemicals.
Formula:C10H19N
InChI:InChI=1/C10H19N/c1-4-8-11(9-5-1)10-6-2-3-7-10/h10H,1-9H2
SMILES:C1CCN(CC1)C1CCCC1
Synonyms:
  • Piperidine, 1-Cyclopentyl-
  • 1-Cyclopentylpiperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.