CAS 7335-17-3
:3,5-Dimethyl-4-octanone
Description:
3,5-Dimethyl-4-octanone, with the CAS number 7335-17-3, is a ketone characterized by its molecular structure, which includes a carbon chain of eight carbon atoms with two methyl groups located at the 3 and 5 positions. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor, often described as sweet or fruity. It is soluble in organic solvents and has limited solubility in water due to its hydrophobic nature. The presence of the ketone functional group contributes to its reactivity, making it useful in various chemical syntheses and applications, including flavoring and fragrance industries. Additionally, 3,5-Dimethyl-4-octanone can be involved in reactions such as oxidation and reduction, which are common for ketones. Safety data indicates that, like many organic solvents, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, this compound is notable for its structural features and potential applications in organic chemistry.
Formula:C10H20O
InChI:InChI=1S/C10H20O/c1-5-7-9(4)10(11)8(3)6-2/h8-9H,5-7H2,1-4H3
InChI key:InChIKey=HIYIOWIWNUWNKQ-UHFFFAOYSA-N
SMILES:C(C(CCC)C)(C(CC)C)=O
Synonyms:- 3,5-Dimethyl-4-Octanone
- 3,5-Dimethyloctan-4-one
- 4-Octanone, 3,5-Dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
